C19H16ClN7O — CID 138989610
2-(3-chlorophenyl)-N-[1-(2-pyridin-4-ylethyl)pyrazol-3-yl]triazole-4-carboxamide (PubChem CID 138989610) has the molecular formula C19H16ClN7O and a molecular weight of 393.84 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-N-[1-(2-pyridin-4-ylethyl)pyrazol-3-yl]triazole-4-carboxamide.
| Compound Name | 2-(3-chlorophenyl)-N-[1-(2-pyridin-4-ylethyl)pyrazol-3-yl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 138989610 |
| Molecular Formula | C19H16ClN7O |
| Molecular Weight | 393.84 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 2-(3-chlorophenyl)-N-[1-(2-pyridin-4-ylethyl)pyrazol-3-yl]triazole-4-carboxamide |
| SMILES | O=C(Nc1ccn(CCc2ccncc2)n1)c1cnn(-c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C19H16ClN7O/c20-15-2-1-3-16(12-15)27-22-13-17(24-27)19(28)23-18-7-11-26(25-18)10-6-14-4-8-21-9-5-14/h1-5,7-9,11-13H,6,10H2,(H,23,25,28) |
| InChIKey | BUHJUZILVPETKI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 90.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.84 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |