C23H23N5O — CID 138989777
[2-[(2-methylbenzimidazol-1-yl)methyl]pyrrolidin-1-yl]-(1-phenylimidazol-4-yl)methanone (PubChem CID 138989777) has the molecular formula C23H23N5O and a molecular weight of 385.47 g/mol. Its IUPAC name is [2-[(2-methylbenzimidazol-1-yl)methyl]pyrrolidin-1-yl]-(1-phenylimidazol-4-yl)methanone.
| Compound Name | [2-[(2-methylbenzimidazol-1-yl)methyl]pyrrolidin-1-yl]-(1-phenylimidazol-4-yl)methanone |
|---|---|
| PubChem CID | 138989777 |
| Molecular Formula | C23H23N5O |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | [2-[(2-methylbenzimidazol-1-yl)methyl]pyrrolidin-1-yl]-(1-phenylimidazol-4-yl)methanone |
| SMILES | Cc1nc2ccccc2n1CC1CCCN1C(=O)c1cn(-c2ccccc2)cn1 |
| InChI | InChI=1S/C23H23N5O/c1-17-25-20-11-5-6-12-22(20)28(17)14-19-10-7-13-27(19)23(29)21-15-26(16-24-21)18-8-3-2-4-9-18/h2-6,8-9,11-12,15-16,19H,7,10,13-14H2,1H3 |
| InChIKey | BJQPZSGRTNRLCQ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 55.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |