C16H24O5 — CID 138989886
3,9-dihydroxy-5-methoxy-5,7,7-trimethyl-4,5a,6,8,8a,9-hexahydro-3H-azuleno[5,6-c]furan-1-one (PubChem CID 138989886) has the molecular formula C16H24O5 and a molecular weight of 296.36 g/mol. Its IUPAC name is 3,9-dihydroxy-5-methoxy-5,7,7-trimethyl-4,5a,6,8,8a,9-hexahydro-3H-azuleno[5,6-c]furan-1-one.
| Compound Name | 3,9-dihydroxy-5-methoxy-5,7,7-trimethyl-4,5a,6,8,8a,9-hexahydro-3H-azuleno[5,6-c]furan-1-one |
|---|---|
| PubChem CID | 138989886 |
| Molecular Formula | C16H24O5 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 3,9-dihydroxy-5-methoxy-5,7,7-trimethyl-4,5a,6,8,8a,9-hexahydro-3H-azuleno[5,6-c]furan-1-one |
| SMILES | COC1(C)CC2=C(C(=O)OC2O)C(O)C2CC(C)(C)CC21 |
| InChI | InChI=1S/C16H24O5/c1-15(2)5-8-10(7-15)16(3,20-4)6-9-11(12(8)17)14(19)21-13(9)18/h8,10,12-13,17-18H,5-7H2,1-4H3 |
| InChIKey | DZDZPCAVKKULFI-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |