C20H30O6 — CID 138990017
methyl (2E,6E)-8-[5-hydroxy-1-(2-methoxy-2-oxoethyl)-2-oxocyclohexyl]-2,6-dimethylocta-2,6-dienoate (PubChem CID 138990017) has the molecular formula C20H30O6 and a molecular weight of 366.45 g/mol. Its IUPAC name is methyl (2E,6E)-8-[5-hydroxy-1-(2-methoxy-2-oxoethyl)-2-oxocyclohexyl]-2,6-dimethylocta-2,6-dienoate.
| Compound Name | methyl (2E,6E)-8-[5-hydroxy-1-(2-methoxy-2-oxoethyl)-2-oxocyclohexyl]-2,6-dimethylocta-2,6-dienoate |
|---|---|
| PubChem CID | 138990017 |
| Molecular Formula | C20H30O6 |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | methyl (2E,6E)-8-[5-hydroxy-1-(2-methoxy-2-oxoethyl)-2-oxocyclohexyl]-2,6-dimethylocta-2,6-dienoate |
| SMILES | COC(=O)CC1(C/C=C(\C)CC/C=C(\C)C(=O)OC)CC(O)CCC1=O |
| InChI | InChI=1S/C20H30O6/c1-14(6-5-7-15(2)19(24)26-4)10-11-20(13-18(23)25-3)12-16(21)8-9-17(20)22/h7,10,16,21H,5-6,8-9,11-13H2,1-4H3/b14-10+,15-7+ |
| InChIKey | SMSSMOBWKOFJTJ-SADFVUDUSA-N |
| XLogP | 2.89 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|