C18H26O5 — CID 138990029
2-[1-[(2E)-3,7-dimethyl-5-oxoocta-2,6-dienyl]-2-hydroxy-5-oxocyclohexyl]acetic acid (PubChem CID 138990029) has the molecular formula C18H26O5 and a molecular weight of 322.40 g/mol. Its IUPAC name is 2-[1-[(2E)-3,7-dimethyl-5-oxoocta-2,6-dienyl]-2-hydroxy-5-oxocyclohexyl]acetic acid.
| Compound Name | 2-[1-[(2E)-3,7-dimethyl-5-oxoocta-2,6-dienyl]-2-hydroxy-5-oxocyclohexyl]acetic acid |
|---|---|
| PubChem CID | 138990029 |
| Molecular Formula | C18H26O5 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 2-[1-[(2E)-3,7-dimethyl-5-oxoocta-2,6-dienyl]-2-hydroxy-5-oxocyclohexyl]acetic acid |
| SMILES | CC(C)=CC(=O)C/C(C)=C/CC1(CC(=O)O)CC(=O)CCC1O |
| InChI | InChI=1S/C18H26O5/c1-12(2)8-15(20)9-13(3)6-7-18(11-17(22)23)10-14(19)4-5-16(18)21/h6,8,16,21H,4-5,7,9-11H2,1-3H3,(H,22,23)/b13-6+ |
| InChIKey | JKEZDMONZRHNLR-AWNIVKPZSA-N |
| XLogP | 2.82 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|