About 3-chloro-5,6,7,8-tetrahydroimidazo[1,2-b]pyridazine
3-chloro-5,6,7,8-tetrahydroimidazo[1,2-b]pyridazine (PubChem CID 138991078) has the molecular formula C6H8ClN3
and a molecular weight of 157.60 g/mol. Its IUPAC name is 3-chloro-5,6,7,8-tetrahydroimidazo[1,2-b]pyridazine.
Analyze 3-chloro-5,6,7,8-tetrahydroimidazo[1,2-b]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-5,6,7,8-tetrahydroimidazo[1,2-b]pyridazine?
The IUPAC name of 3-chloro-5,6,7,8-tetrahydroimidazo[1,2-b]pyridazine (CID 138991078) is 3-chloro-5,6,7,8-tetrahydroimidazo[1,2-b]pyridazine.
What is the SMILES notation for 3-chloro-5,6,7,8-tetrahydroimidazo[1,2-b]pyridazine?
The canonical SMILES for 3-chloro-5,6,7,8-tetrahydroimidazo[1,2-b]pyridazine is Clc1cnc2n1NCCC2.
What is the InChIKey of 3-chloro-5,6,7,8-tetrahydroimidazo[1,2-b]pyridazine?
The InChIKey is RWBATSIYCHASSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8ClN3/c7-5-4-8-6-2-1-3-9-10(5)6/h4,9H,1-3H2.
What are the key properties of 3-chloro-5,6,7,8-tetrahydroimidazo[1,2-b]pyridazine?
3-chloro-5,6,7,8-tetrahydroimidazo[1,2-b]pyridazine has a molecular weight of 157.60 g/mol, XLogP of 1.03, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-5,6,7,8-tetrahydroimidazo[1,2-b]pyridazine is sourced from PubChem (CID 138991078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).