About 2-(2,4-difluorophenyl)-1-(furan-3-yl)-N-methylethanamine;hydrochloride
2-(2,4-difluorophenyl)-1-(furan-3-yl)-N-methylethanamine;hydrochloride (PubChem CID 138991416) has the molecular formula C13H14ClF2NO
and a molecular weight of 273.71 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-1-(furan-3-yl)-N-methylethanamine;hydrochloride.
Molecular Properties
| Compound Name | 2-(2,4-difluorophenyl)-1-(furan-3-yl)-N-methylethanamine;hydrochloride |
| PubChem CID | 138991416 |
| Molecular Formula | C13H14ClF2NO |
| Molecular Weight | 273.71 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 2-(2,4-difluorophenyl)-1-(furan-3-yl)-N-methylethanamine;hydrochloride |
| SMILES | CNC(Cc1ccc(F)cc1F)c1ccoc1.Cl |
| InChI | InChI=1S/C13H13F2NO.ClH/c1-16-13(10-4-5-17-8-10)6-9-2-3-11(14)7-12(9)15;/h2-5,7-8,13,16H,6H2,1H3;1H |
| InChIKey | VUTAKBOHHLWDSX-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.71 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2,4-difluorophenyl)-1-(furan-3-yl)-N-methylethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-difluorophenyl)-1-(furan-3-yl)-N-methylethanamine;hydrochloride?
The IUPAC name of 2-(2,4-difluorophenyl)-1-(furan-3-yl)-N-methylethanamine;hydrochloride (CID 138991416) is 2-(2,4-difluorophenyl)-1-(furan-3-yl)-N-methylethanamine;hydrochloride.
What is the SMILES notation for 2-(2,4-difluorophenyl)-1-(furan-3-yl)-N-methylethanamine;hydrochloride?
The canonical SMILES for 2-(2,4-difluorophenyl)-1-(furan-3-yl)-N-methylethanamine;hydrochloride is CNC(Cc1ccc(F)cc1F)c1ccoc1.Cl.
What is the InChIKey of 2-(2,4-difluorophenyl)-1-(furan-3-yl)-N-methylethanamine;hydrochloride?
The InChIKey is VUTAKBOHHLWDSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13F2NO.ClH/c1-16-13(10-4-5-17-8-10)6-9-2-3-11(14)7-12(9)15;/h2-5,7-8,13,16H,6H2,1H3;1H.
What are the key properties of 2-(2,4-difluorophenyl)-1-(furan-3-yl)-N-methylethanamine;hydrochloride?
2-(2,4-difluorophenyl)-1-(furan-3-yl)-N-methylethanamine;hydrochloride has a molecular weight of 273.71 g/mol, XLogP of 3.48, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-difluorophenyl)-1-(furan-3-yl)-N-methylethanamine;hydrochloride is sourced from PubChem (CID 138991416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).