About 4-(1H-1,2,4-triazol-5-yl)cyclohexan-1-amine;hydrochloride
4-(1H-1,2,4-triazol-5-yl)cyclohexan-1-amine;hydrochloride (PubChem CID 138991550) has the molecular formula C8H15ClN4
and a molecular weight of 202.69 g/mol. Its IUPAC name is 4-(1H-1,2,4-triazol-5-yl)cyclohexan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | 4-(1H-1,2,4-triazol-5-yl)cyclohexan-1-amine;hydrochloride |
| PubChem CID | 138991550 |
| Molecular Formula | C8H15ClN4 |
| Molecular Weight | 202.69 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 4-(1H-1,2,4-triazol-5-yl)cyclohexan-1-amine;hydrochloride |
| SMILES | Cl.NC1CCC(c2ncn[nH]2)CC1 |
| InChI | InChI=1S/C8H14N4.ClH/c9-7-3-1-6(2-4-7)8-10-5-11-12-8;/h5-7H,1-4,9H2,(H,10,11,12);1H |
| InChIKey | ASXBBGJDJUYORZ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.69 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(1H-1,2,4-triazol-5-yl)cyclohexan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1H-1,2,4-triazol-5-yl)cyclohexan-1-amine;hydrochloride?
The IUPAC name of 4-(1H-1,2,4-triazol-5-yl)cyclohexan-1-amine;hydrochloride (CID 138991550) is 4-(1H-1,2,4-triazol-5-yl)cyclohexan-1-amine;hydrochloride.
What is the SMILES notation for 4-(1H-1,2,4-triazol-5-yl)cyclohexan-1-amine;hydrochloride?
The canonical SMILES for 4-(1H-1,2,4-triazol-5-yl)cyclohexan-1-amine;hydrochloride is Cl.NC1CCC(c2ncn[nH]2)CC1.
What is the InChIKey of 4-(1H-1,2,4-triazol-5-yl)cyclohexan-1-amine;hydrochloride?
The InChIKey is ASXBBGJDJUYORZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4.ClH/c9-7-3-1-6(2-4-7)8-10-5-11-12-8;/h5-7H,1-4,9H2,(H,10,11,12);1H.
What are the key properties of 4-(1H-1,2,4-triazol-5-yl)cyclohexan-1-amine;hydrochloride?
4-(1H-1,2,4-triazol-5-yl)cyclohexan-1-amine;hydrochloride has a molecular weight of 202.69 g/mol, XLogP of 1.21, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1H-1,2,4-triazol-5-yl)cyclohexan-1-amine;hydrochloride is sourced from PubChem (CID 138991550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).