About 2-amino-3-(2,4-dioxo-1H-pyrimidin-5-yl)propanoic acid;hydrochloride
2-amino-3-(2,4-dioxo-1H-pyrimidin-5-yl)propanoic acid;hydrochloride (PubChem CID 138991852) has the molecular formula C7H10ClN3O4
and a molecular weight of 235.63 g/mol. Its IUPAC name is 2-amino-3-(2,4-dioxo-1H-pyrimidin-5-yl)propanoic acid;hydrochloride.
Molecular Properties
| Compound Name | 2-amino-3-(2,4-dioxo-1H-pyrimidin-5-yl)propanoic acid;hydrochloride |
| PubChem CID | 138991852 |
| Molecular Formula | C7H10ClN3O4 |
| Molecular Weight | 235.63 g/mol |
| Exact Mass | 235.04 |
| IUPAC Name | 2-amino-3-(2,4-dioxo-1H-pyrimidin-5-yl)propanoic acid;hydrochloride |
| SMILES | Cl.NC(Cc1c[nH]c(=O)[nH]c1=O)C(=O)O |
| InChI | InChI=1S/C7H9N3O4.ClH/c8-4(6(12)13)1-3-2-9-7(14)10-5(3)11;/h2,4H,1,8H2,(H,12,13)(H2,9,10,11,14);1H |
| InChIKey | GSELRJOMFXKPFQ-UHFFFAOYSA-N |
| XLogP | -1.56 |
| TPSA | 129.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.63 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-3-(2,4-dioxo-1H-pyrimidin-5-yl)propanoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-(2,4-dioxo-1H-pyrimidin-5-yl)propanoic acid;hydrochloride?
The IUPAC name of 2-amino-3-(2,4-dioxo-1H-pyrimidin-5-yl)propanoic acid;hydrochloride (CID 138991852) is 2-amino-3-(2,4-dioxo-1H-pyrimidin-5-yl)propanoic acid;hydrochloride.
What is the SMILES notation for 2-amino-3-(2,4-dioxo-1H-pyrimidin-5-yl)propanoic acid;hydrochloride?
The canonical SMILES for 2-amino-3-(2,4-dioxo-1H-pyrimidin-5-yl)propanoic acid;hydrochloride is Cl.NC(Cc1c[nH]c(=O)[nH]c1=O)C(=O)O.
What is the InChIKey of 2-amino-3-(2,4-dioxo-1H-pyrimidin-5-yl)propanoic acid;hydrochloride?
The InChIKey is GSELRJOMFXKPFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O4.ClH/c8-4(6(12)13)1-3-2-9-7(14)10-5(3)11;/h2,4H,1,8H2,(H,12,13)(H2,9,10,11,14);1H.
What are the key properties of 2-amino-3-(2,4-dioxo-1H-pyrimidin-5-yl)propanoic acid;hydrochloride?
2-amino-3-(2,4-dioxo-1H-pyrimidin-5-yl)propanoic acid;hydrochloride has a molecular weight of 235.63 g/mol, XLogP of -1.56, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-(2,4-dioxo-1H-pyrimidin-5-yl)propanoic acid;hydrochloride is sourced from PubChem (CID 138991852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).