About 3-(2-chlorophenyl)-N-[(4,4-difluorocyclohexyl)methyl]-1H-pyrazole-5-carboxamide
3-(2-chlorophenyl)-N-[(4,4-difluorocyclohexyl)methyl]-1H-pyrazole-5-carboxamide (PubChem CID 138992310) has the molecular formula C17H18ClF2N3O
and a molecular weight of 353.80 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-N-[(4,4-difluorocyclohexyl)methyl]-1H-pyrazole-5-carboxamide.
Molecular Properties
| Compound Name | 3-(2-chlorophenyl)-N-[(4,4-difluorocyclohexyl)methyl]-1H-pyrazole-5-carboxamide |
| PubChem CID | 138992310 |
| Molecular Formula | C17H18ClF2N3O |
| Molecular Weight | 353.80 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | 3-(2-chlorophenyl)-N-[(4,4-difluorocyclohexyl)methyl]-1H-pyrazole-5-carboxamide |
| SMILES | O=C(NCC1CCC(F)(F)CC1)c1cc(-c2ccccc2Cl)n[nH]1 |
| InChI | InChI=1S/C17H18ClF2N3O/c18-13-4-2-1-3-12(13)14-9-15(23-22-14)16(24)21-10-11-5-7-17(19,20)8-6-11/h1-4,9,11H,5-8,10H2,(H,21,24)(H,22,23) |
| InChIKey | JZQBMPPYWJHTBK-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.80 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(2-chlorophenyl)-N-[(4,4-difluorocyclohexyl)methyl]-1H-pyrazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-chlorophenyl)-N-[(4,4-difluorocyclohexyl)methyl]-1H-pyrazole-5-carboxamide?
The IUPAC name of 3-(2-chlorophenyl)-N-[(4,4-difluorocyclohexyl)methyl]-1H-pyrazole-5-carboxamide (CID 138992310) is 3-(2-chlorophenyl)-N-[(4,4-difluorocyclohexyl)methyl]-1H-pyrazole-5-carboxamide.
What is the SMILES notation for 3-(2-chlorophenyl)-N-[(4,4-difluorocyclohexyl)methyl]-1H-pyrazole-5-carboxamide?
The canonical SMILES for 3-(2-chlorophenyl)-N-[(4,4-difluorocyclohexyl)methyl]-1H-pyrazole-5-carboxamide is O=C(NCC1CCC(F)(F)CC1)c1cc(-c2ccccc2Cl)n[nH]1.
What is the InChIKey of 3-(2-chlorophenyl)-N-[(4,4-difluorocyclohexyl)methyl]-1H-pyrazole-5-carboxamide?
The InChIKey is JZQBMPPYWJHTBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18ClF2N3O/c18-13-4-2-1-3-12(13)14-9-15(23-22-14)16(24)21-10-11-5-7-17(19,20)8-6-11/h1-4,9,11H,5-8,10H2,(H,21,24)(H,22,23).
What are the key properties of 3-(2-chlorophenyl)-N-[(4,4-difluorocyclohexyl)methyl]-1H-pyrazole-5-carboxamide?
3-(2-chlorophenyl)-N-[(4,4-difluorocyclohexyl)methyl]-1H-pyrazole-5-carboxamide has a molecular weight of 353.80 g/mol, XLogP of 4.29, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-chlorophenyl)-N-[(4,4-difluorocyclohexyl)methyl]-1H-pyrazole-5-carboxamide is sourced from PubChem (CID 138992310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).