C22H23N3O2 — CID 138992571
1-benzyl-N-(8-ethyl-3,4-dihydro-2H-chromen-4-yl)pyrazole-4-carboxamide (PubChem CID 138992571) has the molecular formula C22H23N3O2 and a molecular weight of 361.45 g/mol. Its IUPAC name is 1-benzyl-N-(8-ethyl-3,4-dihydro-2H-chromen-4-yl)pyrazole-4-carboxamide.
| Compound Name | 1-benzyl-N-(8-ethyl-3,4-dihydro-2H-chromen-4-yl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 138992571 |
| Molecular Formula | C22H23N3O2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 1-benzyl-N-(8-ethyl-3,4-dihydro-2H-chromen-4-yl)pyrazole-4-carboxamide |
| SMILES | CCc1cccc2c1OCCC2NC(=O)c1cnn(Cc2ccccc2)c1 |
| InChI | InChI=1S/C22H23N3O2/c1-2-17-9-6-10-19-20(11-12-27-21(17)19)24-22(26)18-13-23-25(15-18)14-16-7-4-3-5-8-16/h3-10,13,15,20H,2,11-12,14H2,1H3,(H,24,26) |
| InChIKey | ZWDJUNAMJYRINT-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |