About 4-[[(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)methylamino]methyl]oxan-4-ol
4-[[(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)methylamino]methyl]oxan-4-ol (PubChem CID 138993196) has the molecular formula C17H24N4O2
and a molecular weight of 316.40 g/mol. Its IUPAC name is 4-[[(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)methylamino]methyl]oxan-4-ol.
Molecular Properties
| Compound Name | 4-[[(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)methylamino]methyl]oxan-4-ol |
| PubChem CID | 138993196 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 4-[[(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)methylamino]methyl]oxan-4-ol |
| SMILES | Cc1nn(-c2ccccn2)c(C)c1CNCC1(O)CCOCC1 |
| InChI | InChI=1S/C17H24N4O2/c1-13-15(11-18-12-17(22)6-9-23-10-7-17)14(2)21(20-13)16-5-3-4-8-19-16/h3-5,8,18,22H,6-7,9-12H2,1-2H3 |
| InChIKey | QZEGWHXDVUESNA-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[[(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)methylamino]methyl]oxan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)methylamino]methyl]oxan-4-ol?
The IUPAC name of 4-[[(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)methylamino]methyl]oxan-4-ol (CID 138993196) is 4-[[(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)methylamino]methyl]oxan-4-ol.
What is the SMILES notation for 4-[[(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)methylamino]methyl]oxan-4-ol?
The canonical SMILES for 4-[[(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)methylamino]methyl]oxan-4-ol is Cc1nn(-c2ccccn2)c(C)c1CNCC1(O)CCOCC1.
What is the InChIKey of 4-[[(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)methylamino]methyl]oxan-4-ol?
The InChIKey is QZEGWHXDVUESNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N4O2/c1-13-15(11-18-12-17(22)6-9-23-10-7-17)14(2)21(20-13)16-5-3-4-8-19-16/h3-5,8,18,22H,6-7,9-12H2,1-2H3.
What are the key properties of 4-[[(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)methylamino]methyl]oxan-4-ol?
4-[[(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)methylamino]methyl]oxan-4-ol has a molecular weight of 316.40 g/mol, XLogP of 1.52, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)methylamino]methyl]oxan-4-ol is sourced from PubChem (CID 138993196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).