About 4-[[(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)methylamino]methyl]-N,N-dimethyloxan-4-amine
4-[[(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)methylamino]methyl]-N,N-dimethyloxan-4-amine (PubChem CID 138993211) has the molecular formula C19H29N5O
and a molecular weight of 343.48 g/mol. Its IUPAC name is 4-[[(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)methylamino]methyl]-N,N-dimethyloxan-4-amine.
Molecular Properties
| Compound Name | 4-[[(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)methylamino]methyl]-N,N-dimethyloxan-4-amine |
| PubChem CID | 138993211 |
| Molecular Formula | C19H29N5O |
| Molecular Weight | 343.48 g/mol |
| Exact Mass | 343.24 |
| IUPAC Name | 4-[[(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)methylamino]methyl]-N,N-dimethyloxan-4-amine |
| SMILES | Cc1nn(-c2ccccn2)c(C)c1CNCC1(N(C)C)CCOCC1 |
| InChI | InChI=1S/C19H29N5O/c1-15-17(16(2)24(22-15)18-7-5-6-10-21-18)13-20-14-19(23(3)4)8-11-25-12-9-19/h5-7,10,20H,8-9,11-14H2,1-4H3 |
| InChIKey | KOVKHEMDTLVLMF-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.48 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[[(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)methylamino]methyl]-N,N-dimethyloxan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)methylamino]methyl]-N,N-dimethyloxan-4-amine?
The IUPAC name of 4-[[(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)methylamino]methyl]-N,N-dimethyloxan-4-amine (CID 138993211) is 4-[[(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)methylamino]methyl]-N,N-dimethyloxan-4-amine.
What is the SMILES notation for 4-[[(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)methylamino]methyl]-N,N-dimethyloxan-4-amine?
The canonical SMILES for 4-[[(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)methylamino]methyl]-N,N-dimethyloxan-4-amine is Cc1nn(-c2ccccn2)c(C)c1CNCC1(N(C)C)CCOCC1.
What is the InChIKey of 4-[[(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)methylamino]methyl]-N,N-dimethyloxan-4-amine?
The InChIKey is KOVKHEMDTLVLMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H29N5O/c1-15-17(16(2)24(22-15)18-7-5-6-10-21-18)13-20-14-19(23(3)4)8-11-25-12-9-19/h5-7,10,20H,8-9,11-14H2,1-4H3.
What are the key properties of 4-[[(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)methylamino]methyl]-N,N-dimethyloxan-4-amine?
4-[[(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)methylamino]methyl]-N,N-dimethyloxan-4-amine has a molecular weight of 343.48 g/mol, XLogP of 2.08, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)methylamino]methyl]-N,N-dimethyloxan-4-amine is sourced from PubChem (CID 138993211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).