C18H18N2O2 — CID 138993218
N-benzyl-3,3-dimethyl-2-oxo-1H-indole-6-carboxamide (PubChem CID 138993218) has the molecular formula C18H18N2O2 and a molecular weight of 294.35 g/mol. Its IUPAC name is N-benzyl-3,3-dimethyl-2-oxo-1H-indole-6-carboxamide.
| Compound Name | N-benzyl-3,3-dimethyl-2-oxo-1H-indole-6-carboxamide |
|---|---|
| PubChem CID | 138993218 |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | N-benzyl-3,3-dimethyl-2-oxo-1H-indole-6-carboxamide |
| SMILES | CC1(C)C(=O)Nc2cc(C(=O)NCc3ccccc3)ccc21 |
| InChI | InChI=1S/C18H18N2O2/c1-18(2)14-9-8-13(10-15(14)20-17(18)22)16(21)19-11-12-6-4-3-5-7-12/h3-10H,11H2,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | UVPVIQXZJGFSQU-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |