About (5-cyclopropyl-1,3-oxazol-4-yl)-[3-(1H-pyrazol-5-yl)piperidin-1-yl]methanone
(5-cyclopropyl-1,3-oxazol-4-yl)-[3-(1H-pyrazol-5-yl)piperidin-1-yl]methanone (PubChem CID 138993848) has the molecular formula C15H18N4O2
and a molecular weight of 286.33 g/mol. Its IUPAC name is (5-cyclopropyl-1,3-oxazol-4-yl)-[3-(1H-pyrazol-5-yl)piperidin-1-yl]methanone.
Molecular Properties
| Compound Name | (5-cyclopropyl-1,3-oxazol-4-yl)-[3-(1H-pyrazol-5-yl)piperidin-1-yl]methanone |
| PubChem CID | 138993848 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | (5-cyclopropyl-1,3-oxazol-4-yl)-[3-(1H-pyrazol-5-yl)piperidin-1-yl]methanone |
| SMILES | O=C(c1ncoc1C1CC1)N1CCCC(c2ccn[nH]2)C1 |
| InChI | InChI=1S/C15H18N4O2/c20-15(13-14(10-3-4-10)21-9-16-13)19-7-1-2-11(8-19)12-5-6-17-18-12/h5-6,9-11H,1-4,7-8H2,(H,17,18) |
| InChIKey | ZRIWLARETNFHLE-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5-cyclopropyl-1,3-oxazol-4-yl)-[3-(1H-pyrazol-5-yl)piperidin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-cyclopropyl-1,3-oxazol-4-yl)-[3-(1H-pyrazol-5-yl)piperidin-1-yl]methanone?
The IUPAC name of (5-cyclopropyl-1,3-oxazol-4-yl)-[3-(1H-pyrazol-5-yl)piperidin-1-yl]methanone (CID 138993848) is (5-cyclopropyl-1,3-oxazol-4-yl)-[3-(1H-pyrazol-5-yl)piperidin-1-yl]methanone.
What is the SMILES notation for (5-cyclopropyl-1,3-oxazol-4-yl)-[3-(1H-pyrazol-5-yl)piperidin-1-yl]methanone?
The canonical SMILES for (5-cyclopropyl-1,3-oxazol-4-yl)-[3-(1H-pyrazol-5-yl)piperidin-1-yl]methanone is O=C(c1ncoc1C1CC1)N1CCCC(c2ccn[nH]2)C1.
What is the InChIKey of (5-cyclopropyl-1,3-oxazol-4-yl)-[3-(1H-pyrazol-5-yl)piperidin-1-yl]methanone?
The InChIKey is ZRIWLARETNFHLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N4O2/c20-15(13-14(10-3-4-10)21-9-16-13)19-7-1-2-11(8-19)12-5-6-17-18-12/h5-6,9-11H,1-4,7-8H2,(H,17,18).
What are the key properties of (5-cyclopropyl-1,3-oxazol-4-yl)-[3-(1H-pyrazol-5-yl)piperidin-1-yl]methanone?
(5-cyclopropyl-1,3-oxazol-4-yl)-[3-(1H-pyrazol-5-yl)piperidin-1-yl]methanone has a molecular weight of 286.33 g/mol, XLogP of 2.29, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-cyclopropyl-1,3-oxazol-4-yl)-[3-(1H-pyrazol-5-yl)piperidin-1-yl]methanone is sourced from PubChem (CID 138993848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).