About 5-(7-ethyl-2,3-dihydroindole-1-carbonyl)-1-methylpyrrole-3-sulfonamide
5-(7-ethyl-2,3-dihydroindole-1-carbonyl)-1-methylpyrrole-3-sulfonamide (PubChem CID 138994394) has the molecular formula C16H19N3O3S
and a molecular weight of 333.41 g/mol. Its IUPAC name is 5-(7-ethyl-2,3-dihydroindole-1-carbonyl)-1-methylpyrrole-3-sulfonamide.
Molecular Properties
| Compound Name | 5-(7-ethyl-2,3-dihydroindole-1-carbonyl)-1-methylpyrrole-3-sulfonamide |
| PubChem CID | 138994394 |
| Molecular Formula | C16H19N3O3S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 5-(7-ethyl-2,3-dihydroindole-1-carbonyl)-1-methylpyrrole-3-sulfonamide |
| SMILES | CCc1cccc2c1N(C(=O)c1cc(S(N)(=O)=O)cn1C)CC2 |
| InChI | InChI=1S/C16H19N3O3S/c1-3-11-5-4-6-12-7-8-19(15(11)12)16(20)14-9-13(10-18(14)2)23(17,21)22/h4-6,9-10H,3,7-8H2,1-2H3,(H2,17,21,22) |
| InChIKey | UWUVTAKMVMVIIC-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 85.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(7-ethyl-2,3-dihydroindole-1-carbonyl)-1-methylpyrrole-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(7-ethyl-2,3-dihydroindole-1-carbonyl)-1-methylpyrrole-3-sulfonamide?
The IUPAC name of 5-(7-ethyl-2,3-dihydroindole-1-carbonyl)-1-methylpyrrole-3-sulfonamide (CID 138994394) is 5-(7-ethyl-2,3-dihydroindole-1-carbonyl)-1-methylpyrrole-3-sulfonamide.
What is the SMILES notation for 5-(7-ethyl-2,3-dihydroindole-1-carbonyl)-1-methylpyrrole-3-sulfonamide?
The canonical SMILES for 5-(7-ethyl-2,3-dihydroindole-1-carbonyl)-1-methylpyrrole-3-sulfonamide is CCc1cccc2c1N(C(=O)c1cc(S(N)(=O)=O)cn1C)CC2.
What is the InChIKey of 5-(7-ethyl-2,3-dihydroindole-1-carbonyl)-1-methylpyrrole-3-sulfonamide?
The InChIKey is UWUVTAKMVMVIIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N3O3S/c1-3-11-5-4-6-12-7-8-19(15(11)12)16(20)14-9-13(10-18(14)2)23(17,21)22/h4-6,9-10H,3,7-8H2,1-2H3,(H2,17,21,22).
What are the key properties of 5-(7-ethyl-2,3-dihydroindole-1-carbonyl)-1-methylpyrrole-3-sulfonamide?
5-(7-ethyl-2,3-dihydroindole-1-carbonyl)-1-methylpyrrole-3-sulfonamide has a molecular weight of 333.41 g/mol, XLogP of 1.44, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(7-ethyl-2,3-dihydroindole-1-carbonyl)-1-methylpyrrole-3-sulfonamide is sourced from PubChem (CID 138994394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).