C17H15F2N3O2S — CID 138994625
3-[(2-cyclopropyl-1,3-thiazol-4-yl)methyl]-5-(2,4-difluorophenyl)-5-methylimidazolidine-2,4-dione (PubChem CID 138994625) has the molecular formula C17H15F2N3O2S and a molecular weight of 363.39 g/mol. Its IUPAC name is 3-[(2-cyclopropyl-1,3-thiazol-4-yl)methyl]-5-(2,4-difluorophenyl)-5-methylimidazolidine-2,4-dione.
| Compound Name | 3-[(2-cyclopropyl-1,3-thiazol-4-yl)methyl]-5-(2,4-difluorophenyl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 138994625 |
| Molecular Formula | C17H15F2N3O2S |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 3-[(2-cyclopropyl-1,3-thiazol-4-yl)methyl]-5-(2,4-difluorophenyl)-5-methylimidazolidine-2,4-dione |
| SMILES | CC1(c2ccc(F)cc2F)NC(=O)N(Cc2csc(C3CC3)n2)C1=O |
| InChI | InChI=1S/C17H15F2N3O2S/c1-17(12-5-4-10(18)6-13(12)19)15(23)22(16(24)21-17)7-11-8-25-14(20-11)9-2-3-9/h4-6,8-9H,2-3,7H2,1H3,(H,21,24) |
| InChIKey | SMZRUUGRSUOPIN-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|