C17H23ClN4O — CID 138995778
N-(1-butylpiperidin-4-yl)-5-chloro-1H-indazole-3-carboxamide (PubChem CID 138995778) has the molecular formula C17H23ClN4O and a molecular weight of 334.85 g/mol. Its IUPAC name is N-(1-butylpiperidin-4-yl)-5-chloro-1H-indazole-3-carboxamide.
| Compound Name | N-(1-butylpiperidin-4-yl)-5-chloro-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 138995778 |
| Molecular Formula | C17H23ClN4O |
| Molecular Weight | 334.85 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | N-(1-butylpiperidin-4-yl)-5-chloro-1H-indazole-3-carboxamide |
| SMILES | CCCCN1CCC(NC(=O)c2n[nH]c3ccc(Cl)cc23)CC1 |
| InChI | InChI=1S/C17H23ClN4O/c1-2-3-8-22-9-6-13(7-10-22)19-17(23)16-14-11-12(18)4-5-15(14)20-21-16/h4-5,11,13H,2-3,6-10H2,1H3,(H,19,23)(H,20,21) |
| InChIKey | RVVUHWHVYLQTGG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.85 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |