About 5-(2-cyclohexylpyrrolidin-1-yl)sulfonyl-1,4-dimethylpyrazole
5-(2-cyclohexylpyrrolidin-1-yl)sulfonyl-1,4-dimethylpyrazole (PubChem CID 138997140) has the molecular formula C15H25N3O2S
and a molecular weight of 311.45 g/mol. Its IUPAC name is 5-(2-cyclohexylpyrrolidin-1-yl)sulfonyl-1,4-dimethylpyrazole.
Molecular Properties
| Compound Name | 5-(2-cyclohexylpyrrolidin-1-yl)sulfonyl-1,4-dimethylpyrazole |
| PubChem CID | 138997140 |
| Molecular Formula | C15H25N3O2S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 5-(2-cyclohexylpyrrolidin-1-yl)sulfonyl-1,4-dimethylpyrazole |
| SMILES | Cc1cnn(C)c1S(=O)(=O)N1CCCC1C1CCCCC1 |
| InChI | InChI=1S/C15H25N3O2S/c1-12-11-16-17(2)15(12)21(19,20)18-10-6-9-14(18)13-7-4-3-5-8-13/h11,13-14H,3-10H2,1-2H3 |
| InChIKey | QLZZVPLDJWHBFF-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(2-cyclohexylpyrrolidin-1-yl)sulfonyl-1,4-dimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-cyclohexylpyrrolidin-1-yl)sulfonyl-1,4-dimethylpyrazole?
The IUPAC name of 5-(2-cyclohexylpyrrolidin-1-yl)sulfonyl-1,4-dimethylpyrazole (CID 138997140) is 5-(2-cyclohexylpyrrolidin-1-yl)sulfonyl-1,4-dimethylpyrazole.
What is the SMILES notation for 5-(2-cyclohexylpyrrolidin-1-yl)sulfonyl-1,4-dimethylpyrazole?
The canonical SMILES for 5-(2-cyclohexylpyrrolidin-1-yl)sulfonyl-1,4-dimethylpyrazole is Cc1cnn(C)c1S(=O)(=O)N1CCCC1C1CCCCC1.
What is the InChIKey of 5-(2-cyclohexylpyrrolidin-1-yl)sulfonyl-1,4-dimethylpyrazole?
The InChIKey is QLZZVPLDJWHBFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N3O2S/c1-12-11-16-17(2)15(12)21(19,20)18-10-6-9-14(18)13-7-4-3-5-8-13/h11,13-14H,3-10H2,1-2H3.
What are the key properties of 5-(2-cyclohexylpyrrolidin-1-yl)sulfonyl-1,4-dimethylpyrazole?
5-(2-cyclohexylpyrrolidin-1-yl)sulfonyl-1,4-dimethylpyrazole has a molecular weight of 311.45 g/mol, XLogP of 2.46, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-cyclohexylpyrrolidin-1-yl)sulfonyl-1,4-dimethylpyrazole is sourced from PubChem (CID 138997140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).