C15H17F2N3O2 — CID 138998345
2-(difluoromethyl)-N-(oxan-3-ylmethyl)-3H-benzimidazole-5-carboxamide (PubChem CID 138998345) has the molecular formula C15H17F2N3O2 and a molecular weight of 309.32 g/mol. Its IUPAC name is 2-(difluoromethyl)-N-(oxan-3-ylmethyl)-3H-benzimidazole-5-carboxamide.
| Compound Name | 2-(difluoromethyl)-N-(oxan-3-ylmethyl)-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 138998345 |
| Molecular Formula | C15H17F2N3O2 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 2-(difluoromethyl)-N-(oxan-3-ylmethyl)-3H-benzimidazole-5-carboxamide |
| SMILES | O=C(NCC1CCCOC1)c1ccc2nc(C(F)F)[nH]c2c1 |
| InChI | InChI=1S/C15H17F2N3O2/c16-13(17)14-19-11-4-3-10(6-12(11)20-14)15(21)18-7-9-2-1-5-22-8-9/h3-4,6,9,13H,1-2,5,7-8H2,(H,18,21)(H,19,20) |
| InChIKey | UUYDXZDECRJRSS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |