C15H15N3O2S — CID 138998483
3-(4,5-dimethyl-1,3-thiazol-2-yl)-5-methyl-5-phenylimidazolidine-2,4-dione (PubChem CID 138998483) has the molecular formula C15H15N3O2S and a molecular weight of 301.37 g/mol. Its IUPAC name is 3-(4,5-dimethyl-1,3-thiazol-2-yl)-5-methyl-5-phenylimidazolidine-2,4-dione.
| Compound Name | 3-(4,5-dimethyl-1,3-thiazol-2-yl)-5-methyl-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 138998483 |
| Molecular Formula | C15H15N3O2S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 3-(4,5-dimethyl-1,3-thiazol-2-yl)-5-methyl-5-phenylimidazolidine-2,4-dione |
| SMILES | Cc1nc(N2C(=O)NC(C)(c3ccccc3)C2=O)sc1C |
| InChI | InChI=1S/C15H15N3O2S/c1-9-10(2)21-14(16-9)18-12(19)15(3,17-13(18)20)11-7-5-4-6-8-11/h4-8H,1-3H3,(H,17,20) |
| InChIKey | MLXASXDQZDGNTA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|