C17H23NO4S — CID 139000314
2-[3-[[(E)-3-cyclopropylprop-2-enyl]sulfamoyl]-2,4,6-trimethylphenyl]acetic acid (PubChem CID 139000314) has the molecular formula C17H23NO4S and a molecular weight of 337.44 g/mol. Its IUPAC name is 2-[3-[[(E)-3-cyclopropylprop-2-enyl]sulfamoyl]-2,4,6-trimethylphenyl]acetic acid.
| Compound Name | 2-[3-[[(E)-3-cyclopropylprop-2-enyl]sulfamoyl]-2,4,6-trimethylphenyl]acetic acid |
|---|---|
| PubChem CID | 139000314 |
| Molecular Formula | C17H23NO4S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 2-[3-[[(E)-3-cyclopropylprop-2-enyl]sulfamoyl]-2,4,6-trimethylphenyl]acetic acid |
| SMILES | Cc1cc(C)c(S(=O)(=O)NC/C=C/C2CC2)c(C)c1CC(=O)O |
| InChI | InChI=1S/C17H23NO4S/c1-11-9-12(2)17(13(3)15(11)10-16(19)20)23(21,22)18-8-4-5-14-6-7-14/h4-5,9,14,18H,6-8,10H2,1-3H3,(H,19,20)/b5-4+ |
| InChIKey | BRTWFDXBDBRVCH-SNAWJCMRSA-N |
| XLogP | 2.48 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|