C16H22N6O — CID 139001207
N-[(4-aminopyrimidin-5-yl)methyl]-1-cyclohexyl-5-methylpyrazole-4-carboxamide (PubChem CID 139001207) has the molecular formula C16H22N6O and a molecular weight of 314.39 g/mol. Its IUPAC name is N-[(4-aminopyrimidin-5-yl)methyl]-1-cyclohexyl-5-methylpyrazole-4-carboxamide.
| Compound Name | N-[(4-aminopyrimidin-5-yl)methyl]-1-cyclohexyl-5-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 139001207 |
| Molecular Formula | C16H22N6O |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | N-[(4-aminopyrimidin-5-yl)methyl]-1-cyclohexyl-5-methylpyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NCc2cncnc2N)cnn1C1CCCCC1 |
| InChI | InChI=1S/C16H22N6O/c1-11-14(9-21-22(11)13-5-3-2-4-6-13)16(23)19-8-12-7-18-10-20-15(12)17/h7,9-10,13H,2-6,8H2,1H3,(H,19,23)(H2,17,18,20) |
| InChIKey | RPXGRMZAYOZQQJ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |