C18H23N5O3 — CID 139001308
[4-methoxy-3-(tetrazol-1-yl)phenyl]-(9-oxa-2-azaspiro[5.5]undecan-2-yl)methanone (PubChem CID 139001308) has the molecular formula C18H23N5O3 and a molecular weight of 357.41 g/mol. Its IUPAC name is [4-methoxy-3-(tetrazol-1-yl)phenyl]-(9-oxa-2-azaspiro[5.5]undecan-2-yl)methanone.
| Compound Name | [4-methoxy-3-(tetrazol-1-yl)phenyl]-(9-oxa-2-azaspiro[5.5]undecan-2-yl)methanone |
|---|---|
| PubChem CID | 139001308 |
| Molecular Formula | C18H23N5O3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | [4-methoxy-3-(tetrazol-1-yl)phenyl]-(9-oxa-2-azaspiro[5.5]undecan-2-yl)methanone |
| SMILES | COc1ccc(C(=O)N2CCCC3(CCOCC3)C2)cc1-n1cnnn1 |
| InChI | InChI=1S/C18H23N5O3/c1-25-16-4-3-14(11-15(16)23-13-19-20-21-23)17(24)22-8-2-5-18(12-22)6-9-26-10-7-18/h3-4,11,13H,2,5-10,12H2,1H3 |
| InChIKey | QCNRKMSSDBOJEC-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 82.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |