C13H23N5O2 — CID 139002271
[4-(2-hydroxy-2-methylpropyl)-2-methylpiperazin-1-yl]-(1-methyltriazol-4-yl)methanone (PubChem CID 139002271) has the molecular formula C13H23N5O2 and a molecular weight of 281.36 g/mol. Its IUPAC name is [4-(2-hydroxy-2-methylpropyl)-2-methylpiperazin-1-yl]-(1-methyltriazol-4-yl)methanone.
| Compound Name | [4-(2-hydroxy-2-methylpropyl)-2-methylpiperazin-1-yl]-(1-methyltriazol-4-yl)methanone |
|---|---|
| PubChem CID | 139002271 |
| Molecular Formula | C13H23N5O2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | [4-(2-hydroxy-2-methylpropyl)-2-methylpiperazin-1-yl]-(1-methyltriazol-4-yl)methanone |
| SMILES | CC1CN(CC(C)(C)O)CCN1C(=O)c1cn(C)nn1 |
| InChI | InChI=1S/C13H23N5O2/c1-10-7-17(9-13(2,3)20)5-6-18(10)12(19)11-8-16(4)15-14-11/h8,10,20H,5-7,9H2,1-4H3 |
| InChIKey | QKTBUCMINCFNDZ-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |