About 2-(5-chloro-2,3-dihydro-1-benzofuran-7-yl)-N-[2-(3-fluorophenyl)-2-hydroxyethyl]acetamide
2-(5-chloro-2,3-dihydro-1-benzofuran-7-yl)-N-[2-(3-fluorophenyl)-2-hydroxyethyl]acetamide (PubChem CID 139002909) has the molecular formula C18H17ClFNO3
and a molecular weight of 349.79 g/mol. Its IUPAC name is 2-(5-chloro-2,3-dihydro-1-benzofuran-7-yl)-N-[2-(3-fluorophenyl)-2-hydroxyethyl]acetamide.
Molecular Properties
| Compound Name | 2-(5-chloro-2,3-dihydro-1-benzofuran-7-yl)-N-[2-(3-fluorophenyl)-2-hydroxyethyl]acetamide |
| PubChem CID | 139002909 |
| Molecular Formula | C18H17ClFNO3 |
| Molecular Weight | 349.79 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 2-(5-chloro-2,3-dihydro-1-benzofuran-7-yl)-N-[2-(3-fluorophenyl)-2-hydroxyethyl]acetamide |
| SMILES | O=C(Cc1cc(Cl)cc2c1OCC2)NCC(O)c1cccc(F)c1 |
| InChI | InChI=1S/C18H17ClFNO3/c19-14-6-12-4-5-24-18(12)13(7-14)9-17(23)21-10-16(22)11-2-1-3-15(20)8-11/h1-3,6-8,16,22H,4-5,9-10H2,(H,21,23) |
| InChIKey | IHRXNBIFJDEHJU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.79 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(5-chloro-2,3-dihydro-1-benzofuran-7-yl)-N-[2-(3-fluorophenyl)-2-hydroxyethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-chloro-2,3-dihydro-1-benzofuran-7-yl)-N-[2-(3-fluorophenyl)-2-hydroxyethyl]acetamide?
The IUPAC name of 2-(5-chloro-2,3-dihydro-1-benzofuran-7-yl)-N-[2-(3-fluorophenyl)-2-hydroxyethyl]acetamide (CID 139002909) is 2-(5-chloro-2,3-dihydro-1-benzofuran-7-yl)-N-[2-(3-fluorophenyl)-2-hydroxyethyl]acetamide.
What is the SMILES notation for 2-(5-chloro-2,3-dihydro-1-benzofuran-7-yl)-N-[2-(3-fluorophenyl)-2-hydroxyethyl]acetamide?
The canonical SMILES for 2-(5-chloro-2,3-dihydro-1-benzofuran-7-yl)-N-[2-(3-fluorophenyl)-2-hydroxyethyl]acetamide is O=C(Cc1cc(Cl)cc2c1OCC2)NCC(O)c1cccc(F)c1.
What is the InChIKey of 2-(5-chloro-2,3-dihydro-1-benzofuran-7-yl)-N-[2-(3-fluorophenyl)-2-hydroxyethyl]acetamide?
The InChIKey is IHRXNBIFJDEHJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17ClFNO3/c19-14-6-12-4-5-24-18(12)13(7-14)9-17(23)21-10-16(22)11-2-1-3-15(20)8-11/h1-3,6-8,16,22H,4-5,9-10H2,(H,21,23).
What are the key properties of 2-(5-chloro-2,3-dihydro-1-benzofuran-7-yl)-N-[2-(3-fluorophenyl)-2-hydroxyethyl]acetamide?
2-(5-chloro-2,3-dihydro-1-benzofuran-7-yl)-N-[2-(3-fluorophenyl)-2-hydroxyethyl]acetamide has a molecular weight of 349.79 g/mol, XLogP of 2.81, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-chloro-2,3-dihydro-1-benzofuran-7-yl)-N-[2-(3-fluorophenyl)-2-hydroxyethyl]acetamide is sourced from PubChem (CID 139002909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).