About [4,4-difluoro-3-(hydroxymethyl)piperidin-1-yl]-[2-(2-methylpropyl)-1,3-thiazol-4-yl]methanone
[4,4-difluoro-3-(hydroxymethyl)piperidin-1-yl]-[2-(2-methylpropyl)-1,3-thiazol-4-yl]methanone (PubChem CID 139004760) has the molecular formula C14H20F2N2O2S
and a molecular weight of 318.39 g/mol. Its IUPAC name is [4,4-difluoro-3-(hydroxymethyl)piperidin-1-yl]-[2-(2-methylpropyl)-1,3-thiazol-4-yl]methanone.
Molecular Properties
| Compound Name | [4,4-difluoro-3-(hydroxymethyl)piperidin-1-yl]-[2-(2-methylpropyl)-1,3-thiazol-4-yl]methanone |
| PubChem CID | 139004760 |
| Molecular Formula | C14H20F2N2O2S |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | [4,4-difluoro-3-(hydroxymethyl)piperidin-1-yl]-[2-(2-methylpropyl)-1,3-thiazol-4-yl]methanone |
| SMILES | CC(C)Cc1nc(C(=O)N2CCC(F)(F)C(CO)C2)cs1 |
| InChI | InChI=1S/C14H20F2N2O2S/c1-9(2)5-12-17-11(8-21-12)13(20)18-4-3-14(15,16)10(6-18)7-19/h8-10,19H,3-7H2,1-2H3 |
| InChIKey | PFYLUGWWSFOMGA-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4,4-difluoro-3-(hydroxymethyl)piperidin-1-yl]-[2-(2-methylpropyl)-1,3-thiazol-4-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4,4-difluoro-3-(hydroxymethyl)piperidin-1-yl]-[2-(2-methylpropyl)-1,3-thiazol-4-yl]methanone?
The IUPAC name of [4,4-difluoro-3-(hydroxymethyl)piperidin-1-yl]-[2-(2-methylpropyl)-1,3-thiazol-4-yl]methanone (CID 139004760) is [4,4-difluoro-3-(hydroxymethyl)piperidin-1-yl]-[2-(2-methylpropyl)-1,3-thiazol-4-yl]methanone.
What is the SMILES notation for [4,4-difluoro-3-(hydroxymethyl)piperidin-1-yl]-[2-(2-methylpropyl)-1,3-thiazol-4-yl]methanone?
The canonical SMILES for [4,4-difluoro-3-(hydroxymethyl)piperidin-1-yl]-[2-(2-methylpropyl)-1,3-thiazol-4-yl]methanone is CC(C)Cc1nc(C(=O)N2CCC(F)(F)C(CO)C2)cs1.
What is the InChIKey of [4,4-difluoro-3-(hydroxymethyl)piperidin-1-yl]-[2-(2-methylpropyl)-1,3-thiazol-4-yl]methanone?
The InChIKey is PFYLUGWWSFOMGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20F2N2O2S/c1-9(2)5-12-17-11(8-21-12)13(20)18-4-3-14(15,16)10(6-18)7-19/h8-10,19H,3-7H2,1-2H3.
What are the key properties of [4,4-difluoro-3-(hydroxymethyl)piperidin-1-yl]-[2-(2-methylpropyl)-1,3-thiazol-4-yl]methanone?
[4,4-difluoro-3-(hydroxymethyl)piperidin-1-yl]-[2-(2-methylpropyl)-1,3-thiazol-4-yl]methanone has a molecular weight of 318.39 g/mol, XLogP of 2.43, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4,4-difluoro-3-(hydroxymethyl)piperidin-1-yl]-[2-(2-methylpropyl)-1,3-thiazol-4-yl]methanone is sourced from PubChem (CID 139004760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).