C18H21N5O — CID 139005001
N-[(6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)methyl]-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 139005001) has the molecular formula C18H21N5O and a molecular weight of 323.40 g/mol. Its IUPAC name is N-[(6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)methyl]-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | N-[(6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)methyl]-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 139005001 |
| Molecular Formula | C18H21N5O |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | N-[(6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)methyl]-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | COc1ccc2c(c1)CCCC2CNc1cc(C)nc2ncnn12 |
| InChI | InChI=1S/C18H21N5O/c1-12-8-17(23-18(22-12)20-11-21-23)19-10-14-5-3-4-13-9-15(24-2)6-7-16(13)14/h6-9,11,14,19H,3-5,10H2,1-2H3 |
| InChIKey | JVNURYNVSZXDRH-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 64.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |