C22H29N3O3 — CID 139005270
8-(1-benzoyl-3-methylpiperidine-3-carbonyl)-2,8-diazaspiro[4.5]decan-3-one (PubChem CID 139005270) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is 8-(1-benzoyl-3-methylpiperidine-3-carbonyl)-2,8-diazaspiro[4.5]decan-3-one.
| Compound Name | 8-(1-benzoyl-3-methylpiperidine-3-carbonyl)-2,8-diazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 139005270 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | 8-(1-benzoyl-3-methylpiperidine-3-carbonyl)-2,8-diazaspiro[4.5]decan-3-one |
| SMILES | CC1(C(=O)N2CCC3(CC2)CNC(=O)C3)CCCN(C(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C22H29N3O3/c1-21(8-5-11-25(16-21)19(27)17-6-3-2-4-7-17)20(28)24-12-9-22(10-13-24)14-18(26)23-15-22/h2-4,6-7H,5,8-16H2,1H3,(H,23,26) |
| InChIKey | OJQYWYYUQVCRGE-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |