C16H21ClN4O2 — CID 139008536
N-[(7-chloro-1-methylbenzimidazol-2-yl)methyl]-3-(hydroxymethyl)piperidine-1-carboxamide (PubChem CID 139008536) has the molecular formula C16H21ClN4O2 and a molecular weight of 336.82 g/mol. Its IUPAC name is N-[(7-chloro-1-methylbenzimidazol-2-yl)methyl]-3-(hydroxymethyl)piperidine-1-carboxamide.
| Compound Name | N-[(7-chloro-1-methylbenzimidazol-2-yl)methyl]-3-(hydroxymethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 139008536 |
| Molecular Formula | C16H21ClN4O2 |
| Molecular Weight | 336.82 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | N-[(7-chloro-1-methylbenzimidazol-2-yl)methyl]-3-(hydroxymethyl)piperidine-1-carboxamide |
| SMILES | Cn1c(CNC(=O)N2CCCC(CO)C2)nc2cccc(Cl)c21 |
| InChI | InChI=1S/C16H21ClN4O2/c1-20-14(19-13-6-2-5-12(17)15(13)20)8-18-16(23)21-7-3-4-11(9-21)10-22/h2,5-6,11,22H,3-4,7-10H2,1H3,(H,18,23) |
| InChIKey | UMIFAUJKDPEBTR-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.82 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |