C18H19F3N6S — CID 139009436
2-[1-[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]piperidin-3-yl]-4,5,6,7-tetrahydro-1,3-benzothiazole (PubChem CID 139009436) has the molecular formula C18H19F3N6S and a molecular weight of 408.45 g/mol. Its IUPAC name is 2-[1-[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]piperidin-3-yl]-4,5,6,7-tetrahydro-1,3-benzothiazole.
| Compound Name | 2-[1-[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]piperidin-3-yl]-4,5,6,7-tetrahydro-1,3-benzothiazole |
|---|---|
| PubChem CID | 139009436 |
| Molecular Formula | C18H19F3N6S |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 2-[1-[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]piperidin-3-yl]-4,5,6,7-tetrahydro-1,3-benzothiazole |
| SMILES | FC(F)(F)c1nnc2ccc(N3CCCC(c4nc5c(s4)CCCC5)C3)nn12 |
| InChI | InChI=1S/C18H19F3N6S/c19-18(20,21)17-24-23-14-7-8-15(25-27(14)17)26-9-3-4-11(10-26)16-22-12-5-1-2-6-13(12)28-16/h7-8,11H,1-6,9-10H2 |
| InChIKey | HNWLKVSSPDKRDK-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 59.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |