C17H17BrN4O2 — CID 139010511
7-(8-bromoquinolin-4-yl)-2-ethyl-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione (PubChem CID 139010511) has the molecular formula C17H17BrN4O2 and a molecular weight of 389.25 g/mol. Its IUPAC name is 7-(8-bromoquinolin-4-yl)-2-ethyl-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione.
| Compound Name | 7-(8-bromoquinolin-4-yl)-2-ethyl-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione |
|---|---|
| PubChem CID | 139010511 |
| Molecular Formula | C17H17BrN4O2 |
| Molecular Weight | 389.25 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | 7-(8-bromoquinolin-4-yl)-2-ethyl-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione |
| SMILES | CCN1C(=O)C2CN(c3ccnc4c(Br)cccc34)CCN2C1=O |
| InChI | InChI=1S/C17H17BrN4O2/c1-2-21-16(23)14-10-20(8-9-22(14)17(21)24)13-6-7-19-15-11(13)4-3-5-12(15)18/h3-7,14H,2,8-10H2,1H3 |
| InChIKey | BOJVWCUWPKLQQF-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.25 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|