C21H23N5O4 — CID 139010979
ethyl 3-[3-[(4,5,6,7-tetrahydro-1-benzofuran-4-ylcarbamoylamino)methyl]phenyl]-1H-1,2,4-triazole-5-carboxylate (PubChem CID 139010979) has the molecular formula C21H23N5O4 and a molecular weight of 409.45 g/mol. Its IUPAC name is ethyl 3-[3-[(4,5,6,7-tetrahydro-1-benzofuran-4-ylcarbamoylamino)methyl]phenyl]-1H-1,2,4-triazole-5-carboxylate.
| Compound Name | ethyl 3-[3-[(4,5,6,7-tetrahydro-1-benzofuran-4-ylcarbamoylamino)methyl]phenyl]-1H-1,2,4-triazole-5-carboxylate |
|---|---|
| PubChem CID | 139010979 |
| Molecular Formula | C21H23N5O4 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | ethyl 3-[3-[(4,5,6,7-tetrahydro-1-benzofuran-4-ylcarbamoylamino)methyl]phenyl]-1H-1,2,4-triazole-5-carboxylate |
| SMILES | CCOC(=O)c1nc(-c2cccc(CNC(=O)NC3CCCc4occc43)c2)n[nH]1 |
| InChI | InChI=1S/C21H23N5O4/c1-2-29-20(27)19-24-18(25-26-19)14-6-3-5-13(11-14)12-22-21(28)23-16-7-4-8-17-15(16)9-10-30-17/h3,5-6,9-11,16H,2,4,7-8,12H2,1H3,(H2,22,23,28)(H,24,25,26) |
| InChIKey | MEKVLQYNTWSGQR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 122.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |