C15H17NO3 — CID 139011442
4-[[cyclobutyl(methyl)amino]methyl]-7-hydroxychromen-2-one (PubChem CID 139011442) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is 4-[[cyclobutyl(methyl)amino]methyl]-7-hydroxychromen-2-one.
| Compound Name | 4-[[cyclobutyl(methyl)amino]methyl]-7-hydroxychromen-2-one |
|---|---|
| PubChem CID | 139011442 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 4-[[cyclobutyl(methyl)amino]methyl]-7-hydroxychromen-2-one |
| SMILES | CN(Cc1cc(=O)oc2cc(O)ccc12)C1CCC1 |
| InChI | InChI=1S/C15H17NO3/c1-16(11-3-2-4-11)9-10-7-15(18)19-14-8-12(17)5-6-13(10)14/h5-8,11,17H,2-4,9H2,1H3 |
| InChIKey | FZTZOPMHEBDYNB-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|