C21H15FN2O3 — CID 139011452
3-fluoro-4-[5-[phenoxy(phenyl)methyl]-1,2,4-oxadiazol-3-yl]phenol (PubChem CID 139011452) has the molecular formula C21H15FN2O3 and a molecular weight of 362.36 g/mol. Its IUPAC name is 3-fluoro-4-[5-[phenoxy(phenyl)methyl]-1,2,4-oxadiazol-3-yl]phenol.
| Compound Name | 3-fluoro-4-[5-[phenoxy(phenyl)methyl]-1,2,4-oxadiazol-3-yl]phenol |
|---|---|
| PubChem CID | 139011452 |
| Molecular Formula | C21H15FN2O3 |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 3-fluoro-4-[5-[phenoxy(phenyl)methyl]-1,2,4-oxadiazol-3-yl]phenol |
| SMILES | Oc1ccc(-c2noc(C(Oc3ccccc3)c3ccccc3)n2)c(F)c1 |
| InChI | InChI=1S/C21H15FN2O3/c22-18-13-15(25)11-12-17(18)20-23-21(27-24-20)19(14-7-3-1-4-8-14)26-16-9-5-2-6-10-16/h1-13,19,25H |
| InChIKey | RITFSCPTCPOYBP-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |