C13H12F3N5 — CID 139013403
3-(6-imidazol-1-ylpyrimidin-4-yl)-1-(trifluoromethyl)-3-azabicyclo[3.1.0]hexane (PubChem CID 139013403) has the molecular formula C13H12F3N5 and a molecular weight of 295.27 g/mol. Its IUPAC name is 3-(6-imidazol-1-ylpyrimidin-4-yl)-1-(trifluoromethyl)-3-azabicyclo[3.1.0]hexane.
| Compound Name | 3-(6-imidazol-1-ylpyrimidin-4-yl)-1-(trifluoromethyl)-3-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 139013403 |
| Molecular Formula | C13H12F3N5 |
| Molecular Weight | 295.27 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 3-(6-imidazol-1-ylpyrimidin-4-yl)-1-(trifluoromethyl)-3-azabicyclo[3.1.0]hexane |
| SMILES | FC(F)(F)C12CC1CN(c1cc(-n3ccnc3)ncn1)C2 |
| InChI | InChI=1S/C13H12F3N5/c14-13(15,16)12-4-9(12)5-21(6-12)11-3-10(18-7-19-11)20-2-1-17-8-20/h1-3,7-9H,4-6H2 |
| InChIKey | IOVWHZKYYKUWBP-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.27 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |