C12H17ClF2N4 — CID 139013969
(8aS)-2-[2-(4-chloropyrazol-1-yl)ethyl]-7,7-difluoro-1,3,4,6,8,8a-hexahydropyrrolo[1,2-a]pyrazine (PubChem CID 139013969) has the molecular formula C12H17ClF2N4 and a molecular weight of 290.74 g/mol. Its IUPAC name is (8aS)-2-[2-(4-chloropyrazol-1-yl)ethyl]-7,7-difluoro-1,3,4,6,8,8a-hexahydropyrrolo[1,2-a]pyrazine.
| Compound Name | (8aS)-2-[2-(4-chloropyrazol-1-yl)ethyl]-7,7-difluoro-1,3,4,6,8,8a-hexahydropyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 139013969 |
| Molecular Formula | C12H17ClF2N4 |
| Molecular Weight | 290.74 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | (8aS)-2-[2-(4-chloropyrazol-1-yl)ethyl]-7,7-difluoro-1,3,4,6,8,8a-hexahydropyrrolo[1,2-a]pyrazine |
| SMILES | FC1(F)C[C@H]2CN(CCn3cc(Cl)cn3)CCN2C1 |
| InChI | InChI=1S/C12H17ClF2N4/c13-10-6-16-19(7-10)4-2-17-1-3-18-9-12(14,15)5-11(18)8-17/h6-7,11H,1-5,8-9H2/t11-/m0/s1 |
| InChIKey | DBTJTTSEKJYNAH-NSHDSACASA-N |
| XLogP | 1.56 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.74 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |