C15H23N7O2 — CID 139014359
1-(6-amino-1-methylpyrazolo[5,4-d]pyrimidin-4-yl)-N-(2-methoxyethyl)piperidine-4-carboxamide (PubChem CID 139014359) has the molecular formula C15H23N7O2 and a molecular weight of 333.40 g/mol. Its IUPAC name is 1-(6-amino-1-methylpyrazolo[5,4-d]pyrimidin-4-yl)-N-(2-methoxyethyl)piperidine-4-carboxamide.
| Compound Name | 1-(6-amino-1-methylpyrazolo[5,4-d]pyrimidin-4-yl)-N-(2-methoxyethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 139014359 |
| Molecular Formula | C15H23N7O2 |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | 1-(6-amino-1-methylpyrazolo[5,4-d]pyrimidin-4-yl)-N-(2-methoxyethyl)piperidine-4-carboxamide |
| SMILES | COCCNC(=O)C1CCN(c2nc(N)nc3c2cnn3C)CC1 |
| InChI | InChI=1S/C15H23N7O2/c1-21-12-11(9-18-21)13(20-15(16)19-12)22-6-3-10(4-7-22)14(23)17-5-8-24-2/h9-10H,3-8H2,1-2H3,(H,17,23)(H2,16,19,20) |
| InChIKey | POPIHXWBJUNVQY-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 111.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|