C17H26N4O2 — CID 139014382
(7R,8aS)-2-(6-cyclohexyloxypyrazin-2-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol (PubChem CID 139014382) has the molecular formula C17H26N4O2 and a molecular weight of 318.42 g/mol. Its IUPAC name is (7R,8aS)-2-(6-cyclohexyloxypyrazin-2-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol.
| Compound Name | (7R,8aS)-2-(6-cyclohexyloxypyrazin-2-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol |
|---|---|
| PubChem CID | 139014382 |
| Molecular Formula | C17H26N4O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | (7R,8aS)-2-(6-cyclohexyloxypyrazin-2-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol |
| SMILES | O[C@@H]1C[C@H]2CN(c3cncc(OC4CCCCC4)n3)CCN2C1 |
| InChI | InChI=1S/C17H26N4O2/c22-14-8-13-11-21(7-6-20(13)12-14)16-9-18-10-17(19-16)23-15-4-2-1-3-5-15/h9-10,13-15,22H,1-8,11-12H2/t13-,14+/m0/s1 |
| InChIKey | LEKJEQFDKCSPDA-UONOGXRCSA-N |
| XLogP | 1.44 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |