About 5-(azepan-1-ylmethyl)-3,4-dimethoxythiophene-2-sulfonamide
5-(azepan-1-ylmethyl)-3,4-dimethoxythiophene-2-sulfonamide (PubChem CID 139014427) has the molecular formula C13H22N2O4S2
and a molecular weight of 334.46 g/mol. Its IUPAC name is 5-(azepan-1-ylmethyl)-3,4-dimethoxythiophene-2-sulfonamide.
Molecular Properties
| Compound Name | 5-(azepan-1-ylmethyl)-3,4-dimethoxythiophene-2-sulfonamide |
| PubChem CID | 139014427 |
| Molecular Formula | C13H22N2O4S2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 5-(azepan-1-ylmethyl)-3,4-dimethoxythiophene-2-sulfonamide |
| SMILES | COc1c(CN2CCCCCC2)sc(S(N)(=O)=O)c1OC |
| InChI | InChI=1S/C13H22N2O4S2/c1-18-11-10(9-15-7-5-3-4-6-8-15)20-13(12(11)19-2)21(14,16)17/h3-9H2,1-2H3,(H2,14,16,17) |
| InChIKey | VJKSZEIJTMDQNT-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(azepan-1-ylmethyl)-3,4-dimethoxythiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(azepan-1-ylmethyl)-3,4-dimethoxythiophene-2-sulfonamide?
The IUPAC name of 5-(azepan-1-ylmethyl)-3,4-dimethoxythiophene-2-sulfonamide (CID 139014427) is 5-(azepan-1-ylmethyl)-3,4-dimethoxythiophene-2-sulfonamide.
What is the SMILES notation for 5-(azepan-1-ylmethyl)-3,4-dimethoxythiophene-2-sulfonamide?
The canonical SMILES for 5-(azepan-1-ylmethyl)-3,4-dimethoxythiophene-2-sulfonamide is COc1c(CN2CCCCCC2)sc(S(N)(=O)=O)c1OC.
What is the InChIKey of 5-(azepan-1-ylmethyl)-3,4-dimethoxythiophene-2-sulfonamide?
The InChIKey is VJKSZEIJTMDQNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2O4S2/c1-18-11-10(9-15-7-5-3-4-6-8-15)20-13(12(11)19-2)21(14,16)17/h3-9H2,1-2H3,(H2,14,16,17).
What are the key properties of 5-(azepan-1-ylmethyl)-3,4-dimethoxythiophene-2-sulfonamide?
5-(azepan-1-ylmethyl)-3,4-dimethoxythiophene-2-sulfonamide has a molecular weight of 334.46 g/mol, XLogP of 1.79, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(azepan-1-ylmethyl)-3,4-dimethoxythiophene-2-sulfonamide is sourced from PubChem (CID 139014427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).