C19H22F3N3O3S — CID 139015189
1-[(4aS,7aS)-1,1-dioxo-4a-(trifluoromethyl)-2,3,4,5,7,7a-hexahydrothiopyrano[2,3-c]pyrrol-6-yl]-4-(benzimidazol-1-yl)butan-1-one (PubChem CID 139015189) has the molecular formula C19H22F3N3O3S and a molecular weight of 429.46 g/mol. Its IUPAC name is 1-[(4aS,7aS)-1,1-dioxo-4a-(trifluoromethyl)-2,3,4,5,7,7a-hexahydrothiopyrano[2,3-c]pyrrol-6-yl]-4-(benzimidazol-1-yl)butan-1-one.
| Compound Name | 1-[(4aS,7aS)-1,1-dioxo-4a-(trifluoromethyl)-2,3,4,5,7,7a-hexahydrothiopyrano[2,3-c]pyrrol-6-yl]-4-(benzimidazol-1-yl)butan-1-one |
|---|---|
| PubChem CID | 139015189 |
| Molecular Formula | C19H22F3N3O3S |
| Molecular Weight | 429.46 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | 1-[(4aS,7aS)-1,1-dioxo-4a-(trifluoromethyl)-2,3,4,5,7,7a-hexahydrothiopyrano[2,3-c]pyrrol-6-yl]-4-(benzimidazol-1-yl)butan-1-one |
| SMILES | O=C(CCCn1cnc2ccccc21)N1C[C@@H]2[C@@](C(F)(F)F)(CCCS2(=O)=O)C1 |
| InChI | InChI=1S/C19H22F3N3O3S/c20-19(21,22)18-8-4-10-29(27,28)16(18)11-25(12-18)17(26)7-3-9-24-13-23-14-5-1-2-6-15(14)24/h1-2,5-6,13,16H,3-4,7-12H2/t16-,18-/m1/s1 |
| InChIKey | IFPKGQXNJBPHSI-SJLPKXTDSA-N |
| XLogP | 2.78 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.46 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |