C12H10F2N6S — CID 139015841
4-[[2-(difluoromethyl)quinazolin-4-yl]amino]-3-methyl-1H-1,2,4-triazole-5-thione (PubChem CID 139015841) has the molecular formula C12H10F2N6S and a molecular weight of 308.32 g/mol. Its IUPAC name is 4-[[2-(difluoromethyl)quinazolin-4-yl]amino]-3-methyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[[2-(difluoromethyl)quinazolin-4-yl]amino]-3-methyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 139015841 |
| Molecular Formula | C12H10F2N6S |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 4-[[2-(difluoromethyl)quinazolin-4-yl]amino]-3-methyl-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1n[nH]c(=S)n1Nc1nc(C(F)F)nc2ccccc12 |
| InChI | InChI=1S/C12H10F2N6S/c1-6-17-18-12(21)20(6)19-10-7-4-2-3-5-8(7)15-11(16-10)9(13)14/h2-5,9H,1H3,(H,18,21)(H,15,16,19) |
| InChIKey | JZGDNTYNILPIHO-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|