C10H17NO3 — CID 139016280
3-hydroxy-3-piperidin-4-ylcyclobutane-1-carboxylic acid (PubChem CID 139016280) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is 3-hydroxy-3-piperidin-4-ylcyclobutane-1-carboxylic acid.
| Compound Name | 3-hydroxy-3-piperidin-4-ylcyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 139016280 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | 3-hydroxy-3-piperidin-4-ylcyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1CC(O)(C2CCNCC2)C1 |
| InChI | InChI=1S/C10H17NO3/c12-9(13)7-5-10(14,6-7)8-1-3-11-4-2-8/h7-8,11,14H,1-6H2,(H,12,13) |
| InChIKey | QNXASAIIVRNBHA-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |