C22H22N4O5S2 — CID 139016612
2-(benzenesulfonamido)-2-phenyl-N-(1-sulfamoyl-2,3-dihydroindol-6-yl)acetamide (PubChem CID 139016612) has the molecular formula C22H22N4O5S2 and a molecular weight of 486.58 g/mol. Its IUPAC name is 2-(benzenesulfonamido)-2-phenyl-N-(1-sulfamoyl-2,3-dihydroindol-6-yl)acetamide.
| Compound Name | 2-(benzenesulfonamido)-2-phenyl-N-(1-sulfamoyl-2,3-dihydroindol-6-yl)acetamide |
|---|---|
| PubChem CID | 139016612 |
| Molecular Formula | C22H22N4O5S2 |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | 2-(benzenesulfonamido)-2-phenyl-N-(1-sulfamoyl-2,3-dihydroindol-6-yl)acetamide |
| SMILES | NS(=O)(=O)N1CCc2ccc(NC(=O)C(NS(=O)(=O)c3ccccc3)c3ccccc3)cc21 |
| InChI | InChI=1S/C22H22N4O5S2/c23-33(30,31)26-14-13-16-11-12-18(15-20(16)26)24-22(27)21(17-7-3-1-4-8-17)25-32(28,29)19-9-5-2-6-10-19/h1-12,15,21,25H,13-14H2,(H,24,27)(H2,23,30,31) |
| InChIKey | XNFFNNIOESQOKE-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 138.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |