About cyclohexylmethyl 4-(5-amino-3-methyl-1,2,4-triazol-1-yl)piperidine-1-carboxylate
cyclohexylmethyl 4-(5-amino-3-methyl-1,2,4-triazol-1-yl)piperidine-1-carboxylate (PubChem CID 139017523) has the molecular formula C16H27N5O2
and a molecular weight of 321.43 g/mol. Its IUPAC name is cyclohexylmethyl 4-(5-amino-3-methyl-1,2,4-triazol-1-yl)piperidine-1-carboxylate.
Molecular Properties
| Compound Name | cyclohexylmethyl 4-(5-amino-3-methyl-1,2,4-triazol-1-yl)piperidine-1-carboxylate |
| PubChem CID | 139017523 |
| Molecular Formula | C16H27N5O2 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | cyclohexylmethyl 4-(5-amino-3-methyl-1,2,4-triazol-1-yl)piperidine-1-carboxylate |
| SMILES | Cc1nc(N)n(C2CCN(C(=O)OCC3CCCCC3)CC2)n1 |
| InChI | InChI=1S/C16H27N5O2/c1-12-18-15(17)21(19-12)14-7-9-20(10-8-14)16(22)23-11-13-5-3-2-4-6-13/h13-14H,2-11H2,1H3,(H2,17,18,19) |
| InChIKey | CRPXVYLZXAZINX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze cyclohexylmethyl 4-(5-amino-3-methyl-1,2,4-triazol-1-yl)piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexylmethyl 4-(5-amino-3-methyl-1,2,4-triazol-1-yl)piperidine-1-carboxylate?
The IUPAC name of cyclohexylmethyl 4-(5-amino-3-methyl-1,2,4-triazol-1-yl)piperidine-1-carboxylate (CID 139017523) is cyclohexylmethyl 4-(5-amino-3-methyl-1,2,4-triazol-1-yl)piperidine-1-carboxylate.
What is the SMILES notation for cyclohexylmethyl 4-(5-amino-3-methyl-1,2,4-triazol-1-yl)piperidine-1-carboxylate?
The canonical SMILES for cyclohexylmethyl 4-(5-amino-3-methyl-1,2,4-triazol-1-yl)piperidine-1-carboxylate is Cc1nc(N)n(C2CCN(C(=O)OCC3CCCCC3)CC2)n1.
What is the InChIKey of cyclohexylmethyl 4-(5-amino-3-methyl-1,2,4-triazol-1-yl)piperidine-1-carboxylate?
The InChIKey is CRPXVYLZXAZINX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27N5O2/c1-12-18-15(17)21(19-12)14-7-9-20(10-8-14)16(22)23-11-13-5-3-2-4-6-13/h13-14H,2-11H2,1H3,(H2,17,18,19).
What are the key properties of cyclohexylmethyl 4-(5-amino-3-methyl-1,2,4-triazol-1-yl)piperidine-1-carboxylate?
cyclohexylmethyl 4-(5-amino-3-methyl-1,2,4-triazol-1-yl)piperidine-1-carboxylate has a molecular weight of 321.43 g/mol, XLogP of 2.52, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexylmethyl 4-(5-amino-3-methyl-1,2,4-triazol-1-yl)piperidine-1-carboxylate is sourced from PubChem (CID 139017523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).