C17H22N6O2 — CID 139018271
1-[2-(3,6-dihydro-2H-pyran-4-yl)-2-methylpropyl]-3-[2-(1,2,4-triazol-1-yl)-3-pyridinyl]urea (PubChem CID 139018271) has the molecular formula C17H22N6O2 and a molecular weight of 342.40 g/mol. Its IUPAC name is 1-[2-(3,6-dihydro-2H-pyran-4-yl)-2-methylpropyl]-3-[2-(1,2,4-triazol-1-yl)-3-pyridinyl]urea.
| Compound Name | 1-[2-(3,6-dihydro-2H-pyran-4-yl)-2-methylpropyl]-3-[2-(1,2,4-triazol-1-yl)-3-pyridinyl]urea |
|---|---|
| PubChem CID | 139018271 |
| Molecular Formula | C17H22N6O2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 1-[2-(3,6-dihydro-2H-pyran-4-yl)-2-methylpropyl]-3-[2-(1,2,4-triazol-1-yl)-3-pyridinyl]urea |
| SMILES | CC(C)(CNC(=O)Nc1cccnc1-n1cncn1)C1=CCOCC1 |
| InChI | InChI=1S/C17H22N6O2/c1-17(2,13-5-8-25-9-6-13)10-20-16(24)22-14-4-3-7-19-15(14)23-12-18-11-21-23/h3-5,7,11-12H,6,8-10H2,1-2H3,(H2,20,22,24) |
| InChIKey | BWMXNNFYVQDYRL-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|