About 1-benzyl-N-[(1,1-dioxothian-3-yl)methyl]tetrazol-5-amine
1-benzyl-N-[(1,1-dioxothian-3-yl)methyl]tetrazol-5-amine (PubChem CID 139019384) has the molecular formula C14H19N5O2S
and a molecular weight of 321.41 g/mol. Its IUPAC name is 1-benzyl-N-[(1,1-dioxothian-3-yl)methyl]tetrazol-5-amine.
Molecular Properties
| Compound Name | 1-benzyl-N-[(1,1-dioxothian-3-yl)methyl]tetrazol-5-amine |
| PubChem CID | 139019384 |
| Molecular Formula | C14H19N5O2S |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 1-benzyl-N-[(1,1-dioxothian-3-yl)methyl]tetrazol-5-amine |
| SMILES | O=S1(=O)CCCC(CNc2nnnn2Cc2ccccc2)C1 |
| InChI | InChI=1S/C14H19N5O2S/c20-22(21)8-4-7-13(11-22)9-15-14-16-17-18-19(14)10-12-5-2-1-3-6-12/h1-3,5-6,13H,4,7-11H2,(H,15,16,18) |
| InChIKey | ZUBMYLFANSCNQD-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-benzyl-N-[(1,1-dioxothian-3-yl)methyl]tetrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-N-[(1,1-dioxothian-3-yl)methyl]tetrazol-5-amine?
The IUPAC name of 1-benzyl-N-[(1,1-dioxothian-3-yl)methyl]tetrazol-5-amine (CID 139019384) is 1-benzyl-N-[(1,1-dioxothian-3-yl)methyl]tetrazol-5-amine.
What is the SMILES notation for 1-benzyl-N-[(1,1-dioxothian-3-yl)methyl]tetrazol-5-amine?
The canonical SMILES for 1-benzyl-N-[(1,1-dioxothian-3-yl)methyl]tetrazol-5-amine is O=S1(=O)CCCC(CNc2nnnn2Cc2ccccc2)C1.
What is the InChIKey of 1-benzyl-N-[(1,1-dioxothian-3-yl)methyl]tetrazol-5-amine?
The InChIKey is ZUBMYLFANSCNQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N5O2S/c20-22(21)8-4-7-13(11-22)9-15-14-16-17-18-19(14)10-12-5-2-1-3-6-12/h1-3,5-6,13H,4,7-11H2,(H,15,16,18).
What are the key properties of 1-benzyl-N-[(1,1-dioxothian-3-yl)methyl]tetrazol-5-amine?
1-benzyl-N-[(1,1-dioxothian-3-yl)methyl]tetrazol-5-amine has a molecular weight of 321.41 g/mol, XLogP of 0.96, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-N-[(1,1-dioxothian-3-yl)methyl]tetrazol-5-amine is sourced from PubChem (CID 139019384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).