About 3-[1-(2,3-difluorophenyl)triazol-4-yl]-2,2-dimethylpropan-1-ol
3-[1-(2,3-difluorophenyl)triazol-4-yl]-2,2-dimethylpropan-1-ol (PubChem CID 139019704) has the molecular formula C13H15F2N3O
and a molecular weight of 267.28 g/mol. Its IUPAC name is 3-[1-(2,3-difluorophenyl)triazol-4-yl]-2,2-dimethylpropan-1-ol.
Molecular Properties
| Compound Name | 3-[1-(2,3-difluorophenyl)triazol-4-yl]-2,2-dimethylpropan-1-ol |
| PubChem CID | 139019704 |
| Molecular Formula | C13H15F2N3O |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 3-[1-(2,3-difluorophenyl)triazol-4-yl]-2,2-dimethylpropan-1-ol |
| SMILES | CC(C)(CO)Cc1cn(-c2cccc(F)c2F)nn1 |
| InChI | InChI=1S/C13H15F2N3O/c1-13(2,8-19)6-9-7-18(17-16-9)11-5-3-4-10(14)12(11)15/h3-5,7,19H,6,8H2,1-2H3 |
| InChIKey | RKXZZXDAELFMFS-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[1-(2,3-difluorophenyl)triazol-4-yl]-2,2-dimethylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(2,3-difluorophenyl)triazol-4-yl]-2,2-dimethylpropan-1-ol?
The IUPAC name of 3-[1-(2,3-difluorophenyl)triazol-4-yl]-2,2-dimethylpropan-1-ol (CID 139019704) is 3-[1-(2,3-difluorophenyl)triazol-4-yl]-2,2-dimethylpropan-1-ol.
What is the SMILES notation for 3-[1-(2,3-difluorophenyl)triazol-4-yl]-2,2-dimethylpropan-1-ol?
The canonical SMILES for 3-[1-(2,3-difluorophenyl)triazol-4-yl]-2,2-dimethylpropan-1-ol is CC(C)(CO)Cc1cn(-c2cccc(F)c2F)nn1.
What is the InChIKey of 3-[1-(2,3-difluorophenyl)triazol-4-yl]-2,2-dimethylpropan-1-ol?
The InChIKey is RKXZZXDAELFMFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15F2N3O/c1-13(2,8-19)6-9-7-18(17-16-9)11-5-3-4-10(14)12(11)15/h3-5,7,19H,6,8H2,1-2H3.
What are the key properties of 3-[1-(2,3-difluorophenyl)triazol-4-yl]-2,2-dimethylpropan-1-ol?
3-[1-(2,3-difluorophenyl)triazol-4-yl]-2,2-dimethylpropan-1-ol has a molecular weight of 267.28 g/mol, XLogP of 2.11, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(2,3-difluorophenyl)triazol-4-yl]-2,2-dimethylpropan-1-ol is sourced from PubChem (CID 139019704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).