C12H19N5O2 — CID 139019770
1-(2-methylpropyl)-3-(2-propan-2-yl-1,2,4-triazol-3-yl)imidazolidine-2,4-dione (PubChem CID 139019770) has the molecular formula C12H19N5O2 and a molecular weight of 265.32 g/mol. Its IUPAC name is 1-(2-methylpropyl)-3-(2-propan-2-yl-1,2,4-triazol-3-yl)imidazolidine-2,4-dione.
| Compound Name | 1-(2-methylpropyl)-3-(2-propan-2-yl-1,2,4-triazol-3-yl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 139019770 |
| Molecular Formula | C12H19N5O2 |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 1-(2-methylpropyl)-3-(2-propan-2-yl-1,2,4-triazol-3-yl)imidazolidine-2,4-dione |
| SMILES | CC(C)CN1CC(=O)N(c2ncnn2C(C)C)C1=O |
| InChI | InChI=1S/C12H19N5O2/c1-8(2)5-15-6-10(18)16(12(15)19)11-13-7-14-17(11)9(3)4/h7-9H,5-6H2,1-4H3 |
| InChIKey | LAGFNSLNXJUGKN-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|