C16H19NO2 — CID 139020274
2-cyclohex-2-en-1-yl-3,4-dihydro-1H-isoquinoline-6-carboxylic acid (PubChem CID 139020274) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is 2-cyclohex-2-en-1-yl-3,4-dihydro-1H-isoquinoline-6-carboxylic acid.
| Compound Name | 2-cyclohex-2-en-1-yl-3,4-dihydro-1H-isoquinoline-6-carboxylic acid |
|---|---|
| PubChem CID | 139020274 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 2-cyclohex-2-en-1-yl-3,4-dihydro-1H-isoquinoline-6-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)CCN(C1C=CCCC1)C2 |
| InChI | InChI=1S/C16H19NO2/c18-16(19)13-6-7-14-11-17(9-8-12(14)10-13)15-4-2-1-3-5-15/h2,4,6-7,10,15H,1,3,5,8-9,11H2,(H,18,19) |
| InChIKey | NBXSCQNOLFKHLI-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|